C11H13F4N — CID 19433019
(4-butyl-2,3,5,6-tetrafluorophenyl)methanamine (PubChem CID 19433019) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is (4-butyl-2,3,5,6-tetrafluorophenyl)methanamine.
| Compound Name | (4-butyl-2,3,5,6-tetrafluorophenyl)methanamine |
|---|---|
| PubChem CID | 19433019 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (4-butyl-2,3,5,6-tetrafluorophenyl)methanamine |
| SMILES | CCCCc1c(F)c(F)c(CN)c(F)c1F |
| InChI | InChI=1S/C11H13F4N/c1-2-3-4-6-8(12)10(14)7(5-16)11(15)9(6)13/h2-5,16H2,1H3 |
| InChIKey | OOYUHDIAWWKLRA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|