C17H12F8W — CID 58185849
3-butyl-1,2,4,5-tetrafluorobenzene-6-ide;1,2,4,5-tetrafluoro-3-methylbenzene-6-ide;tungsten(2+) (PubChem CID 58185849) has the molecular formula C17H12F8W and a molecular weight of 552.11 g/mol. Its IUPAC name is 3-butyl-1,2,4,5-tetrafluorobenzene-6-ide;1,2,4,5-tetrafluoro-3-methylbenzene-6-ide;tungsten(2+).
| Compound Name | 3-butyl-1,2,4,5-tetrafluorobenzene-6-ide;1,2,4,5-tetrafluoro-3-methylbenzene-6-ide;tungsten(2+) |
|---|---|
| PubChem CID | 58185849 |
| Molecular Formula | C17H12F8W |
| Molecular Weight | 552.11 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | 3-butyl-1,2,4,5-tetrafluorobenzene-6-ide;1,2,4,5-tetrafluoro-3-methylbenzene-6-ide;tungsten(2+) |
| SMILES | CCCCc1c(F)c(F)[c-]c(F)c1F.Cc1c(F)c(F)[c-]c(F)c1F.[W+2] |
| InChI | InChI=1S/C10H9F4.C7H3F4.W/c1-2-3-4-6-9(13)7(11)5-8(12)10(6)14;1-3-6(10)4(8)2-5(9)7(3)11;/h2-4H2,1H3;1H3;/q2*-1;+2 |
| InChIKey | HVVLNASCDOLOQS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.11 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|