C11H13F3O3S — CID 59676532
1-butyl-2,3,6-trifluoro-5-methyl-4-(trioxidanylsulfanyl)benzene (PubChem CID 59676532) has the molecular formula C11H13F3O3S and a molecular weight of 282.28 g/mol. Its IUPAC name is 1-butyl-2,3,6-trifluoro-5-methyl-4-(trioxidanylsulfanyl)benzene.
| Compound Name | 1-butyl-2,3,6-trifluoro-5-methyl-4-(trioxidanylsulfanyl)benzene |
|---|---|
| PubChem CID | 59676532 |
| Molecular Formula | C11H13F3O3S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-butyl-2,3,6-trifluoro-5-methyl-4-(trioxidanylsulfanyl)benzene |
| SMILES | CCCCc1c(F)c(C)c(SOOO)c(F)c1F |
| InChI | InChI=1S/C11H13F3O3S/c1-3-4-5-7-8(12)6(2)11(18-17-16-15)10(14)9(7)13/h15H,3-5H2,1-2H3 |
| InChIKey | OVXKWDPXKJYFGS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|