C22H35F3O4S — CID 59414751
1-tert-butyl-2-(2-butyloctoxy)-3,4,6-trifluoro-5-(trioxidanylsulfanyl)benzene (PubChem CID 59414751) has the molecular formula C22H35F3O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-butyloctoxy)-3,4,6-trifluoro-5-(trioxidanylsulfanyl)benzene.
| Compound Name | 1-tert-butyl-2-(2-butyloctoxy)-3,4,6-trifluoro-5-(trioxidanylsulfanyl)benzene |
|---|---|
| PubChem CID | 59414751 |
| Molecular Formula | C22H35F3O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-tert-butyl-2-(2-butyloctoxy)-3,4,6-trifluoro-5-(trioxidanylsulfanyl)benzene |
| SMILES | CCCCCCC(CCCC)COc1c(F)c(F)c(SOOO)c(F)c1C(C)(C)C |
| InChI | InChI=1S/C22H35F3O4S/c1-6-8-10-11-13-15(12-9-7-2)14-27-20-16(22(3,4)5)17(23)21(30-29-28-26)19(25)18(20)24/h15,26H,6-14H2,1-5H3 |
| InChIKey | IZYLHVSSTSJHPM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|