About CID 178056197
CID 178056197 (PubChem CID 178056197) has the molecular formula C16H33BO
and a molecular weight of 252.25 g/mol.
Molecular Properties
| Compound Name | CID 178056197 |
| PubChem CID | 178056197 |
| Molecular Formula | C16H33BO |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | — |
| SMILES | [B]OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C16H33BO/c1-3-5-7-9-10-12-14-16(15-18-17)13-11-8-6-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | GECXDQMJYJGIBP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178056197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178056197?
The IUPAC name of CID 178056197 (CID 178056197) is not available.
What is the SMILES notation for CID 178056197?
The canonical SMILES for CID 178056197 is [B]OCC(CCCCCC)CCCCCCCC.
What is the InChIKey of CID 178056197?
The InChIKey is GECXDQMJYJGIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33BO/c1-3-5-7-9-10-12-14-16(15-18-17)13-11-8-6-4-2/h16H,3-15H2,1-2H3.
What are the key properties of CID 178056197?
CID 178056197 has a molecular weight of 252.25 g/mol, XLogP of 5.42, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178056197 is sourced from PubChem (CID 178056197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).