C18H26F4O5S2 — CID 58961973
1-(2-butyloctylsulfonyl)-2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)benzene (PubChem CID 58961973) has the molecular formula C18H26F4O5S2 and a molecular weight of 462.53 g/mol. Its IUPAC name is 1-(2-butyloctylsulfonyl)-2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)benzene.
| Compound Name | 1-(2-butyloctylsulfonyl)-2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)benzene |
|---|---|
| PubChem CID | 58961973 |
| Molecular Formula | C18H26F4O5S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1-(2-butyloctylsulfonyl)-2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)benzene |
| SMILES | CCCCCCC(CCCC)CS(=O)(=O)c1c(F)c(F)c(SOOO)c(F)c1F |
| InChI | InChI=1S/C18H26F4O5S2/c1-3-5-7-8-10-12(9-6-4-2)11-29(24,25)18-15(21)13(19)17(28-27-26-23)14(20)16(18)22/h12,23H,3-11H2,1-2H3 |
| InChIKey | PHSSDOKZVAKMHS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|