C11H9F7 — CID 14092719
1-butyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (PubChem CID 14092719) has the molecular formula C11H9F7 and a molecular weight of 274.18 g/mol. Its IUPAC name is 1-butyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-butyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 14092719 |
| Molecular Formula | C11H9F7 |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-butyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| SMILES | CCCCc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C11H9F7/c1-2-3-4-5-7(12)9(14)6(11(16,17)18)10(15)8(5)13/h2-4H2,1H3 |
| InChIKey | IEKKSYZPDFPDSA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|