C10H4F7N — CID 174986528
3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 174986528) has the molecular formula C10H4F7N and a molecular weight of 271.13 g/mol. Its IUPAC name is 3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | 3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 174986528 |
| Molecular Formula | C10H4F7N |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | N#CCCc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H4F7N/c11-6-4(2-1-3-18)7(12)9(14)5(8(6)13)10(15,16)17/h1-2H2 |
| InChIKey | IAFOVKMAJNZZRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|