C14H7F7 — CID 154487763
1-benzyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (PubChem CID 154487763) has the molecular formula C14H7F7 and a molecular weight of 308.20 g/mol. Its IUPAC name is 1-benzyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-benzyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154487763 |
| Molecular Formula | C14H7F7 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-benzyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1Cc1ccccc1 |
| InChI | InChI=1S/C14H7F7/c15-10-8(6-7-4-2-1-3-5-7)11(16)13(18)9(12(10)17)14(19,20)21/h1-5H,6H2 |
| InChIKey | PARCGIXGEUCFNW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|