C22H15F6N — CID 150875981
2-benzyl-3,4-bis(trifluoromethyl)-9H-fluoren-1-amine (PubChem CID 150875981) has the molecular formula C22H15F6N and a molecular weight of 407.36 g/mol. Its IUPAC name is 2-benzyl-3,4-bis(trifluoromethyl)-9H-fluoren-1-amine.
| Compound Name | 2-benzyl-3,4-bis(trifluoromethyl)-9H-fluoren-1-amine |
|---|---|
| PubChem CID | 150875981 |
| Molecular Formula | C22H15F6N |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-benzyl-3,4-bis(trifluoromethyl)-9H-fluoren-1-amine |
| SMILES | Nc1c2c(c(C(F)(F)F)c(C(F)(F)F)c1Cc1ccccc1)-c1ccccc1C2 |
| InChI | InChI=1S/C22H15F6N/c23-21(24,25)18-16(10-12-6-2-1-3-7-12)20(29)15-11-13-8-4-5-9-14(13)17(15)19(18)22(26,27)28/h1-9H,10-11,29H2 |
| InChIKey | KVAAPEPLDFWCKN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|