C13H14N4 — CID 67197336
9H-fluorene-1,2,3,4-tetramine (PubChem CID 67197336) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 9H-fluorene-1,2,3,4-tetramine.
| Compound Name | 9H-fluorene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 67197336 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 9H-fluorene-1,2,3,4-tetramine |
| SMILES | Nc1c(N)c(N)c2c(c1N)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H14N4/c14-10-8-5-6-3-1-2-4-7(6)9(8)11(15)13(17)12(10)16/h1-4H,5,14-17H2 |
| InChIKey | LASLIALYACASEA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|