About 9H-fluoren-4-amine;1-phenyl-9H-fluorene
9H-fluoren-4-amine;1-phenyl-9H-fluorene (PubChem CID 175396170) has the molecular formula C32H25N
and a molecular weight of 423.56 g/mol. Its IUPAC name is 9H-fluoren-4-amine;1-phenyl-9H-fluorene.
Molecular Properties
| Compound Name | 9H-fluoren-4-amine;1-phenyl-9H-fluorene |
| PubChem CID | 175396170 |
| Molecular Formula | C32H25N |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 9H-fluoren-4-amine;1-phenyl-9H-fluorene |
| SMILES | Nc1cccc2c1-c1ccccc1C2.c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C19H14.C13H11N/c1-2-7-14(8-3-1)16-11-6-12-18-17-10-5-4-9-15(17)13-19(16)18;14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-12H,13H2;1-7H,8,14H2 |
| InChIKey | DQVDWSZOHRIALW-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-4-amine;1-phenyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-4-amine;1-phenyl-9H-fluorene?
The IUPAC name of 9H-fluoren-4-amine;1-phenyl-9H-fluorene (CID 175396170) is 9H-fluoren-4-amine;1-phenyl-9H-fluorene.
What is the SMILES notation for 9H-fluoren-4-amine;1-phenyl-9H-fluorene?
The canonical SMILES for 9H-fluoren-4-amine;1-phenyl-9H-fluorene is Nc1cccc2c1-c1ccccc1C2.c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1.
What is the InChIKey of 9H-fluoren-4-amine;1-phenyl-9H-fluorene?
The InChIKey is DQVDWSZOHRIALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14.C13H11N/c1-2-7-14(8-3-1)16-11-6-12-18-17-10-5-4-9-15(17)13-19(16)18;14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-12H,13H2;1-7H,8,14H2.
What are the key properties of 9H-fluoren-4-amine;1-phenyl-9H-fluorene?
9H-fluoren-4-amine;1-phenyl-9H-fluorene has a molecular weight of 423.56 g/mol, XLogP of 7.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-4-amine;1-phenyl-9H-fluorene is sourced from PubChem (CID 175396170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).