About 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole
1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole (PubChem CID 175076817) has the molecular formula C23H16F3N
and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole.
Molecular Properties
| Compound Name | 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole |
| PubChem CID | 175076817 |
| Molecular Formula | C23H16F3N |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole |
| SMILES | FC(F)(F)c1ccc2c(c1Cc1ccccc1)Cc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C23H16F3N/c24-23(25,26)20-11-10-16-17(18(20)12-14-6-2-1-3-7-14)13-19-15-8-4-5-9-21(15)27-22(16)19/h1-11,27H,12-13H2 |
| InChIKey | QFTLSBAVQSTQGX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole?
The IUPAC name of 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole (CID 175076817) is 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole.
What is the SMILES notation for 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole?
The canonical SMILES for 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole is FC(F)(F)c1ccc2c(c1Cc1ccccc1)Cc1c-2[nH]c2ccccc12.
What is the InChIKey of 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole?
The InChIKey is QFTLSBAVQSTQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F3N/c24-23(25,26)20-11-10-16-17(18(20)12-14-6-2-1-3-7-14)13-19-15-8-4-5-9-21(15)27-22(16)19/h1-11,27H,12-13H2.
What are the key properties of 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole?
1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole has a molecular weight of 363.38 g/mol, XLogP of 6.35, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(trifluoromethyl)-5,10-dihydroindeno[1,2-b]indole is sourced from PubChem (CID 175076817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).