C19H23N — CID 143208166
5,10-dihydroindeno[1,2-b]indole;ethane (PubChem CID 143208166) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 5,10-dihydroindeno[1,2-b]indole;ethane.
| Compound Name | 5,10-dihydroindeno[1,2-b]indole;ethane |
|---|---|
| PubChem CID | 143208166 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5,10-dihydroindeno[1,2-b]indole;ethane |
| SMILES | CC.CC.c1ccc2c(c1)Cc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C15H11N.2C2H6/c1-2-6-11-10(5-1)9-13-12-7-3-4-8-14(12)16-15(11)13;2*1-2/h1-8,16H,9H2;2*1-2H3 |
| InChIKey | CSFVQELHVGNNSN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |