C17H15NO2 — CID 91287320
6,11-dihydroindeno[1,2-c]isoquinolin-5-one;methanol (PubChem CID 91287320) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 6,11-dihydroindeno[1,2-c]isoquinolin-5-one;methanol.
| Compound Name | 6,11-dihydroindeno[1,2-c]isoquinolin-5-one;methanol |
|---|---|
| PubChem CID | 91287320 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6,11-dihydroindeno[1,2-c]isoquinolin-5-one;methanol |
| SMILES | CO.O=c1[nH]c2c(c3ccccc13)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H11NO.CH4O/c18-16-13-8-4-3-7-12(13)14-9-10-5-1-2-6-11(10)15(14)17-16;1-2/h1-8H,9H2,(H,17,18);2H,1H3 |
| InChIKey | CPLBIMZZGGFOPO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |