C18H17NO — CID 161223927
methane;9-methyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 161223927) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is methane;9-methyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | methane;9-methyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 161223927 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methane;9-methyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | C.Cc1ccc2c(c1)Cc1c-2[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H13NO.CH4/c1-10-6-7-12-11(8-10)9-15-13-4-2-3-5-14(13)17(19)18-16(12)15;/h2-8H,9H2,1H3,(H,18,19);1H4 |
| InChIKey | UXWKYOQUCRVQOU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |