C18H15NO — CID 58593003
8,9-dimethyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 58593003) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 8,9-dimethyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 8,9-dimethyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 58593003 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 8,9-dimethyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | Cc1cc2c(cc1C)-c1[nH]c(=O)c3ccccc3c1C2 |
| InChI | InChI=1S/C18H15NO/c1-10-7-12-9-16-13-5-3-4-6-14(13)18(20)19-17(16)15(12)8-11(10)2/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | IKHZZOKGOYXQSP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |