C19H18N2OS — CID 46865692
10-[(dimethylamino)methylsulfanyl]-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 46865692) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is 10-[(dimethylamino)methylsulfanyl]-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 10-[(dimethylamino)methylsulfanyl]-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 46865692 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 10-[(dimethylamino)methylsulfanyl]-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | CN(C)CSc1cccc2c1Cc1c-2[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H18N2OS/c1-21(2)11-23-17-9-5-8-13-15(17)10-16-12-6-3-4-7-14(12)19(22)20-18(13)16/h3-9H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | LPRZIPDSFOSDPO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|