C25H31N — CID 145125960
9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene;ethane (PubChem CID 145125960) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is 9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene;ethane.
| Compound Name | 9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene;ethane |
|---|---|
| PubChem CID | 145125960 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene;ethane |
| SMILES | CC.CC.CC.c1ccc2c(c1)Cc1ccc3[nH]c4ccccc4c3c1-2 |
| InChI | InChI=1S/C19H13N.3C2H6/c1-2-6-14-12(5-1)11-13-9-10-17-19(18(13)14)15-7-3-4-8-16(15)20-17;3*1-2/h1-10,20H,11H2;3*1-2H3 |
| InChIKey | PNYZQRQAUHPQEC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |