About 7,12-dihydroindeno[1,2-a]carbazole
7,12-dihydroindeno[1,2-a]carbazole (PubChem CID 58472013) has the molecular formula C19H13N
and a molecular weight of 255.32 g/mol. Its IUPAC name is 7,12-dihydroindeno[1,2-a]carbazole.
Molecular Properties
| Compound Name | 7,12-dihydroindeno[1,2-a]carbazole |
| PubChem CID | 58472013 |
| Molecular Formula | C19H13N |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 7,12-dihydroindeno[1,2-a]carbazole |
| SMILES | c1ccc2c(c1)Cc1ccc3c([nH]c4ccccc43)c1-2 |
| InChI | InChI=1S/C19H13N/c1-2-6-14-12(5-1)11-13-9-10-16-15-7-3-4-8-17(15)20-19(16)18(13)14/h1-10,20H,11H2 |
| InChIKey | BNUDKPLUOVBZFI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7,12-dihydroindeno[1,2-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,12-dihydroindeno[1,2-a]carbazole?
The IUPAC name of 7,12-dihydroindeno[1,2-a]carbazole (CID 58472013) is 7,12-dihydroindeno[1,2-a]carbazole.
What is the SMILES notation for 7,12-dihydroindeno[1,2-a]carbazole?
The canonical SMILES for 7,12-dihydroindeno[1,2-a]carbazole is c1ccc2c(c1)Cc1ccc3c([nH]c4ccccc43)c1-2.
What is the InChIKey of 7,12-dihydroindeno[1,2-a]carbazole?
The InChIKey is BNUDKPLUOVBZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N/c1-2-6-14-12(5-1)11-13-9-10-16-15-7-3-4-8-17(15)20-19(16)18(13)14/h1-10,20H,11H2.
What are the key properties of 7,12-dihydroindeno[1,2-a]carbazole?
7,12-dihydroindeno[1,2-a]carbazole has a molecular weight of 255.32 g/mol, XLogP of 4.89, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,12-dihydroindeno[1,2-a]carbazole is sourced from PubChem (CID 58472013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).