C22H13NO2 — CID 58434746
3-azahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaene-12,14-dione (PubChem CID 58434746) has the molecular formula C22H13NO2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-azahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaene-12,14-dione.
| Compound Name | 3-azahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58434746 |
| Molecular Formula | C22H13NO2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-azahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaene-12,14-dione |
| SMILES | O=C1CC(=O)c2c1c1c(c3[nH]c4ccccc4c23)Cc2ccccc2-1 |
| InChI | InChI=1S/C22H13NO2/c24-16-10-17(25)21-19-13-7-3-4-8-15(13)23-22(19)14-9-11-5-1-2-6-12(11)18(14)20(16)21/h1-8,23H,9-10H2 |
| InChIKey | OXQIFGTWUSJIPI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|