About CID 169220550
CID 169220550 (PubChem CID 169220550) has the molecular formula C18H11NSi
and a molecular weight of 269.38 g/mol.
Molecular Properties
| Compound Name | CID 169220550 |
| PubChem CID | 169220550 |
| Molecular Formula | C18H11NSi |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)[Si]c1ccc3[nH]c4ccccc4c3c1-2 |
| InChI | InChI=1S/C18H11NSi/c1-3-7-13-11(5-1)17-14(19-13)9-10-16-18(17)12-6-2-4-8-15(12)20-16/h1-10,19H |
| InChIKey | INRPDPXBWBDOOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169220550 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169220550?
The IUPAC name of CID 169220550 (CID 169220550) is not available.
What is the SMILES notation for CID 169220550?
The canonical SMILES for CID 169220550 is c1ccc2c(c1)[Si]c1ccc3[nH]c4ccccc4c3c1-2.
What is the InChIKey of CID 169220550?
The InChIKey is INRPDPXBWBDOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NSi/c1-3-7-13-11(5-1)17-14(19-13)9-10-16-18(17)12-6-2-4-8-15(12)20-16/h1-10,19H.
What are the key properties of CID 169220550?
CID 169220550 has a molecular weight of 269.38 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169220550 is sourced from PubChem (CID 169220550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).