C14H9N3O — CID 70462618
18-oxa-10,15,16-triazapentacyclo[13.2.1.02,14.03,11.04,9]octadeca-1(17),2(14),3(11),4,6,8,12-heptaene (PubChem CID 70462618) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is 18-oxa-10,15,16-triazapentacyclo[13.2.1.02,14.03,11.04,9]octadeca-1(17),2(14),3(11),4,6,8,12-heptaene.
| Compound Name | 18-oxa-10,15,16-triazapentacyclo[13.2.1.02,14.03,11.04,9]octadeca-1(17),2(14),3(11),4,6,8,12-heptaene |
|---|---|
| PubChem CID | 70462618 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 18-oxa-10,15,16-triazapentacyclo[13.2.1.02,14.03,11.04,9]octadeca-1(17),2(14),3(11),4,6,8,12-heptaene |
| SMILES | C1=C2ON(N1)c1ccc3[nH]c4ccccc4c3c12 |
| InChI | InChI=1S/C14H9N3O/c1-2-4-9-8(3-1)13-10(16-9)5-6-11-14(13)12-7-15-17(11)18-12/h1-7,15-16H |
| InChIKey | YYEKAHPXEJEUBA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |