About 4-phenyl-9H-carbazole
4-phenyl-9H-carbazole (PubChem CID 22990274) has the molecular formula C18H13N
and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-phenyl-9H-carbazole.
Molecular Properties
| Compound Name | 4-phenyl-9H-carbazole |
| PubChem CID | 22990274 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-phenyl-9H-carbazole |
| SMILES | c1ccc(-c2cccc3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C18H13N/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17/h1-12,19H |
| InChIKey | MHYZYLQHHQNSPV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-phenyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-9H-carbazole?
The IUPAC name of 4-phenyl-9H-carbazole (CID 22990274) is 4-phenyl-9H-carbazole.
What is the SMILES notation for 4-phenyl-9H-carbazole?
The canonical SMILES for 4-phenyl-9H-carbazole is c1ccc(-c2cccc3[nH]c4ccccc4c23)cc1.
What is the InChIKey of 4-phenyl-9H-carbazole?
The InChIKey is MHYZYLQHHQNSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17/h1-12,19H.
What are the key properties of 4-phenyl-9H-carbazole?
4-phenyl-9H-carbazole has a molecular weight of 243.31 g/mol, XLogP of 4.99, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-9H-carbazole is sourced from PubChem (CID 22990274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).