C36H25N — CID 175875661
1,2-dideuterio-3,4-bis(2-phenylphenyl)-9H-carbazole (PubChem CID 175875661) has the molecular formula C36H25N and a molecular weight of 473.62 g/mol. Its IUPAC name is 1,2-dideuterio-3,4-bis(2-phenylphenyl)-9H-carbazole.
| Compound Name | 1,2-dideuterio-3,4-bis(2-phenylphenyl)-9H-carbazole |
|---|---|
| PubChem CID | 175875661 |
| Molecular Formula | C36H25N |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 1,2-dideuterio-3,4-bis(2-phenylphenyl)-9H-carbazole |
| SMILES | [2H]c1c(-c2ccccc2-c2ccccc2)c(-c2ccccc2-c2ccccc2)c2c([nH]c3ccccc32)c1[2H] |
| InChI | InChI=1S/C36H25N/c1-3-13-25(14-4-1)27-17-7-9-19-29(27)31-23-24-34-36(32-21-11-12-22-33(32)37-34)35(31)30-20-10-8-18-28(30)26-15-5-2-6-16-26/h1-24,37H/i23D,24D |
| InChIKey | WLCONNLHWOOXRY-JOZDILNBSA-N |
| XLogP | 9.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |