C18H13N — CID 177093171
1,2,4-trideuterio-3-phenyl-9H-carbazole (PubChem CID 177093171) has the molecular formula C18H13N and a molecular weight of 246.33 g/mol. Its IUPAC name is 1,2,4-trideuterio-3-phenyl-9H-carbazole.
| Compound Name | 1,2,4-trideuterio-3-phenyl-9H-carbazole |
|---|---|
| PubChem CID | 177093171 |
| Molecular Formula | C18H13N |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1,2,4-trideuterio-3-phenyl-9H-carbazole |
| SMILES | [2H]c1c(-c2ccccc2)c([2H])c2c([nH]c3ccccc32)c1[2H] |
| InChI | InChI=1S/C18H13N/c1-2-6-13(7-3-1)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19-18/h1-12,19H/i10D,11D,12D |
| InChIKey | IAWRFMPNMXEJCK-VKLAAILXSA-N |
| XLogP | 4.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |