About 2-methyl-5,11-dihydroindeno[1,2-b]carbazole
2-methyl-5,11-dihydroindeno[1,2-b]carbazole (PubChem CID 146579673) has the molecular formula C20H15N
and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-methyl-5,11-dihydroindeno[1,2-b]carbazole.
Molecular Properties
| Compound Name | 2-methyl-5,11-dihydroindeno[1,2-b]carbazole |
| PubChem CID | 146579673 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-methyl-5,11-dihydroindeno[1,2-b]carbazole |
| SMILES | Cc1ccc2[nH]c3cc4c(cc3c2c1)Cc1ccccc1-4 |
| InChI | InChI=1S/C20H15N/c1-12-6-7-19-17(8-12)18-10-14-9-13-4-2-3-5-15(13)16(14)11-20(18)21-19/h2-8,10-11,21H,9H2,1H3 |
| InChIKey | UJBCZQZIOJBUHC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-5,11-dihydroindeno[1,2-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,11-dihydroindeno[1,2-b]carbazole?
The IUPAC name of 2-methyl-5,11-dihydroindeno[1,2-b]carbazole (CID 146579673) is 2-methyl-5,11-dihydroindeno[1,2-b]carbazole.
What is the SMILES notation for 2-methyl-5,11-dihydroindeno[1,2-b]carbazole?
The canonical SMILES for 2-methyl-5,11-dihydroindeno[1,2-b]carbazole is Cc1ccc2[nH]c3cc4c(cc3c2c1)Cc1ccccc1-4.
What is the InChIKey of 2-methyl-5,11-dihydroindeno[1,2-b]carbazole?
The InChIKey is UJBCZQZIOJBUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N/c1-12-6-7-19-17(8-12)18-10-14-9-13-4-2-3-5-15(13)16(14)11-20(18)21-19/h2-8,10-11,21H,9H2,1H3.
What are the key properties of 2-methyl-5,11-dihydroindeno[1,2-b]carbazole?
2-methyl-5,11-dihydroindeno[1,2-b]carbazole has a molecular weight of 269.35 g/mol, XLogP of 5.20, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,11-dihydroindeno[1,2-b]carbazole is sourced from PubChem (CID 146579673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).