C19H12N+ — CID 159717785
5,11-dihydro-3H-indeno[1,2-b]carbazol-3-ylium (PubChem CID 159717785) has the molecular formula C19H12N+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 5,11-dihydro-3H-indeno[1,2-b]carbazol-3-ylium.
| Compound Name | 5,11-dihydro-3H-indeno[1,2-b]carbazol-3-ylium |
|---|---|
| PubChem CID | 159717785 |
| Molecular Formula | C19H12N+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5,11-dihydro-3H-indeno[1,2-b]carbazol-3-ylium |
| SMILES | [C+]1=Cc2[nH]c3cc4c(cc3c2C=C1)Cc1ccccc1-4 |
| InChI | InChI=1S/C19H12N/c1-2-6-14-12(5-1)9-13-10-17-15-7-3-4-8-18(15)20-19(17)11-16(13)14/h1-3,5-8,10-11,20H,9H2/q+1 |
| InChIKey | UGZHXQQRIZIHHC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|