C17H15NO — CID 22408513
8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole (PubChem CID 22408513) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole.
| Compound Name | 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 22408513 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole |
| SMILES | COc1cc(C)c2[nH]c3c(c2c1)Cc1ccccc1-3 |
| InChI | InChI=1S/C17H15NO/c1-10-7-12(19-2)9-15-14-8-11-5-3-4-6-13(11)17(14)18-16(10)15/h3-7,9,18H,8H2,1-2H3 |
| InChIKey | NYXZUTYFNGVQLQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |