About 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole
8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole (PubChem CID 22408513) has the molecular formula C17H15NO
and a molecular weight of 249.31 g/mol. Its IUPAC name is 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole.
Molecular Properties
| Compound Name | 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole |
| PubChem CID | 22408513 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole |
| SMILES | COc1cc(C)c2[nH]c3c(c2c1)Cc1ccccc1-3 |
| InChI | InChI=1S/C17H15NO/c1-10-7-12(19-2)9-15-14-8-11-5-3-4-6-13(11)17(14)18-16(10)15/h3-7,9,18H,8H2,1-2H3 |
| InChIKey | NYXZUTYFNGVQLQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole?
The IUPAC name of 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole (CID 22408513) is 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole.
What is the SMILES notation for 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole?
The canonical SMILES for 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole is COc1cc(C)c2[nH]c3c(c2c1)Cc1ccccc1-3.
What is the InChIKey of 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole?
The InChIKey is NYXZUTYFNGVQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO/c1-10-7-12(19-2)9-15-14-8-11-5-3-4-6-13(11)17(14)18-16(10)15/h3-7,9,18H,8H2,1-2H3.
What are the key properties of 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole?
8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole has a molecular weight of 249.31 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-6-methyl-5,10-dihydroindeno[1,2-b]indole is sourced from PubChem (CID 22408513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).