C18H15N — CID 18715259
2-methylidene-18-azatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),3,5,7,12,14,16-heptaene (PubChem CID 18715259) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-methylidene-18-azatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),3,5,7,12,14,16-heptaene.
| Compound Name | 2-methylidene-18-azatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),3,5,7,12,14,16-heptaene |
|---|---|
| PubChem CID | 18715259 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-methylidene-18-azatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),3,5,7,12,14,16-heptaene |
| SMILES | C=C1c2ccccc2CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H15N/c1-12-14-7-3-2-6-13(14)10-11-16-15-8-4-5-9-17(15)19-18(12)16/h2-9,19H,1,10-11H2 |
| InChIKey | OUIGSLXKVZVMQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |