C25H19N3 — CID 14318406
2,5,27-triazaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1,3(15),4(12),6,8,10,16,20(28),21,23,25-undecaene (PubChem CID 14318406) has the molecular formula C25H19N3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2,5,27-triazaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1,3(15),4(12),6,8,10,16,20(28),21,23,25-undecaene.
| Compound Name | 2,5,27-triazaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1,3(15),4(12),6,8,10,16,20(28),21,23,25-undecaene |
|---|---|
| PubChem CID | 14318406 |
| Molecular Formula | C25H19N3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2,5,27-triazaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1,3(15),4(12),6,8,10,16,20(28),21,23,25-undecaene |
| SMILES | c1ccc2c3c([nH]c2c1)-c1nc2c(cc1CC3)CCc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C25H19N3/c1-3-7-20-16(5-1)18-11-9-14-13-15-10-12-19-17-6-2-4-8-21(17)27-25(19)23(15)28-22(14)24(18)26-20/h1-8,13,26-27H,9-12H2 |
| InChIKey | LFKRAKDSWQIBCH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|