C18H13BrN2O — CID 71423282
(3-bromophenyl)-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanone (PubChem CID 71423282) has the molecular formula C18H13BrN2O and a molecular weight of 353.22 g/mol. Its IUPAC name is (3-bromophenyl)-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanone.
| Compound Name | (3-bromophenyl)-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanone |
|---|---|
| PubChem CID | 71423282 |
| Molecular Formula | C18H13BrN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (3-bromophenyl)-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methanone |
| SMILES | O=C(C1=NCCc2c1[nH]c1ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H13BrN2O/c19-12-5-3-4-11(10-12)18(22)17-16-14(8-9-20-17)13-6-1-2-7-15(13)21-16/h1-7,10,21H,8-9H2 |
| InChIKey | WMNMVSFXUTUXPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|