C17H13ClN2 — CID 11242982
1-(4-chlorophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 11242982) has the molecular formula C17H13ClN2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 1-(4-chlorophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11242982 |
| Molecular Formula | C17H13ClN2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(4-chlorophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | Clc1ccc(C2=NCCc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C17H13ClN2/c18-12-7-5-11(6-8-12)16-17-14(9-10-19-16)13-3-1-2-4-15(13)20-17/h1-8,20H,9-10H2 |
| InChIKey | ZRDNLLAUBQMZOQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|