C23H15Cl2NO2 — CID 177395487
3,3-bis(4-chlorophenyl)-4,9-dihydropyrano[3,4-b]indol-1-one (PubChem CID 177395487) has the molecular formula C23H15Cl2NO2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)-4,9-dihydropyrano[3,4-b]indol-1-one.
| Compound Name | 3,3-bis(4-chlorophenyl)-4,9-dihydropyrano[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 177395487 |
| Molecular Formula | C23H15Cl2NO2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)-4,9-dihydropyrano[3,4-b]indol-1-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C23H15Cl2NO2/c24-16-9-5-14(6-10-16)23(15-7-11-17(25)12-8-15)13-19-18-3-1-2-4-20(18)26-21(19)22(27)28-23/h1-12,26H,13H2 |
| InChIKey | RNKSGNNYGMZSPQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|