C21H20ClN3O2 — CID 53013270
(4-chlorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 53013270) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53013270 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (4-chlorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20ClN3O2/c1-14-17-4-2-3-5-18(17)23-19(14)21(27)25-12-10-24(11-13-25)20(26)15-6-8-16(22)9-7-15/h2-9,23H,10-13H2,1H3 |
| InChIKey | HZKOSBIBRGTCRC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|