C21H19F2N3O2 — CID 53013289
(3,4-difluorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 53013289) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53013289 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (3,4-difluorophenyl)-[4-(3-methyl-1H-indole-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)c3ccc(F)c(F)c3)CC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19F2N3O2/c1-13-15-4-2-3-5-18(15)24-19(13)21(28)26-10-8-25(9-11-26)20(27)14-6-7-16(22)17(23)12-14/h2-7,12,24H,8-11H2,1H3 |
| InChIKey | KKGBQSOMBKMSPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|