C21H21F2N3O — CID 110397417
(3,4-difluorophenyl)-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]methanone (PubChem CID 110397417) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110397417 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3,4-difluorophenyl)-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccccc2c1CN1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H21F2N3O/c1-14-17(16-4-2-3-5-20(16)24-14)13-25-8-10-26(11-9-25)21(27)15-6-7-18(22)19(23)12-15/h2-7,12,24H,8-11,13H2,1H3 |
| InChIKey | BDMSZNMFLMRQIZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|