C21H25N3OS — CID 110397428
1-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 110397428) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 110397428 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[4-[(2-methyl-1H-indol-3-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1CN1CCN(C(=O)CCc2cccs2)CC1 |
| InChI | InChI=1S/C21H25N3OS/c1-16-19(18-6-2-3-7-20(18)22-16)15-23-10-12-24(13-11-23)21(25)9-8-17-5-4-14-26-17/h2-7,14,22H,8-13,15H2,1H3 |
| InChIKey | HRWZOIJOTCASFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|