C19H16ClN3O — CID 135849252
4-chloro-N-[(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]benzamide (PubChem CID 135849252) has the molecular formula C19H16ClN3O and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-chloro-N-[(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]benzamide |
|---|---|
| PubChem CID | 135849252 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-chloro-N-[(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]benzamide |
| SMILES | O=C(N/N=C1\CCCc2c1[nH]c1ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O/c20-13-10-8-12(9-11-13)19(24)23-22-17-7-3-5-15-14-4-1-2-6-16(14)21-18(15)17/h1-2,4,6,8-11,21H,3,5,7H2,(H,23,24)/b22-17+ |
| InChIKey | BXFVPXHNIIMZRP-OQKWZONESA-N |
| XLogP | 4.29 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|