C19H19N5O — CID 135465352
(8E)-8-(methylhydrazinylidene)-N-pyridin-3-yl-5,6,7,9-tetrahydrocarbazole-3-carboxamide (PubChem CID 135465352) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is (8E)-8-(methylhydrazinylidene)-N-pyridin-3-yl-5,6,7,9-tetrahydrocarbazole-3-carboxamide.
| Compound Name | (8E)-8-(methylhydrazinylidene)-N-pyridin-3-yl-5,6,7,9-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 135465352 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (8E)-8-(methylhydrazinylidene)-N-pyridin-3-yl-5,6,7,9-tetrahydrocarbazole-3-carboxamide |
| SMILES | CN/N=C1\CCCc2c1[nH]c1ccc(C(=O)Nc3cccnc3)cc21 |
| InChI | InChI=1S/C19H19N5O/c1-20-24-17-6-2-5-14-15-10-12(7-8-16(15)23-18(14)17)19(25)22-13-4-3-9-21-11-13/h3-4,7-11,20,23H,2,5-6H2,1H3,(H,22,25)/b24-17+ |
| InChIKey | NCWVIKRFTNHLRO-JJIBRWJFSA-N |
| XLogP | 3.08 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|