C17H13N3O2 — CID 11426319
1-(4-nitrophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 11426319) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 1-(4-nitrophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11426319 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(4-nitrophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1ccc(C2=NCCc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C17H13N3O2/c21-20(22)12-7-5-11(6-8-12)16-17-14(9-10-18-16)13-3-1-2-4-15(13)19-17/h1-8,19H,9-10H2 |
| InChIKey | RXKUJSKBPAXEPN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|