About 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole
1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 132837986) has the molecular formula C18H16N2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| PubChem CID | 132837986 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | Cc1ccc(C2=NCCc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C18H16N2/c1-12-6-8-13(9-7-12)17-18-15(10-11-19-17)14-4-2-3-5-16(14)20-18/h2-9,20H,10-11H2,1H3 |
| InChIKey | DHBAGYSIRMPKJV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole?
The IUPAC name of 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (CID 132837986) is 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
What is the SMILES notation for 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole?
The canonical SMILES for 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole is Cc1ccc(C2=NCCc3c2[nH]c2ccccc32)cc1.
What is the InChIKey of 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole?
The InChIKey is DHBAGYSIRMPKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2/c1-12-6-8-13(9-7-12)17-18-15(10-11-19-17)14-4-2-3-5-16(14)20-18/h2-9,20H,10-11H2,1H3.
What are the key properties of 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole?
1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole has a molecular weight of 260.34 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-4,9-dihydro-3H-pyrido[3,4-b]indole is sourced from PubChem (CID 132837986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).