C21H17F3N2O4 — CID 174857403
4-methylbenzene-1,3-dicarboxylic acid;1-(trifluoromethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 174857403) has the molecular formula C21H17F3N2O4 and a molecular weight of 418.37 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;1-(trifluoromethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;1-(trifluoromethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 174857403 |
| Molecular Formula | C21H17F3N2O4 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;1-(trifluoromethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.FC(F)(F)C1=NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C12H9F3N2.C9H8O4/c13-12(14,15)11-10-8(5-6-16-11)7-3-1-2-4-9(7)17-10;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-4,17H,5-6H2;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | LDDFBVFNQGWOFM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|