C19H27ClN2 — CID 135755225
1-octyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 135755225) has the molecular formula C19H27ClN2 and a molecular weight of 318.89 g/mol. Its IUPAC name is 1-octyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 1-octyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 135755225 |
| Molecular Formula | C19H27ClN2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-octyl-4,9-dihydro-3H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | CCCCCCCCC1=NCCc2c1[nH]c1ccccc21.Cl |
| InChI | InChI=1S/C19H26N2.ClH/c1-2-3-4-5-6-7-12-18-19-16(13-14-20-18)15-10-8-9-11-17(15)21-19;/h8-11,21H,2-7,12-14H2,1H3;1H |
| InChIKey | JTFMJMKPDDAEHR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|