About 1-nonyl-9H-carbazole
1-nonyl-9H-carbazole (PubChem CID 66872642) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-nonyl-9H-carbazole.
Molecular Properties
| Compound Name | 1-nonyl-9H-carbazole |
| PubChem CID | 66872642 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-nonyl-9H-carbazole |
| SMILES | CCCCCCCCCc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C21H27N/c1-2-3-4-5-6-7-8-12-17-13-11-15-19-18-14-9-10-16-20(18)22-21(17)19/h9-11,13-16,22H,2-8,12H2,1H3 |
| InChIKey | GBEIZYKXXVPFOB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonyl-9H-carbazole?
The IUPAC name of 1-nonyl-9H-carbazole (CID 66872642) is 1-nonyl-9H-carbazole.
What is the SMILES notation for 1-nonyl-9H-carbazole?
The canonical SMILES for 1-nonyl-9H-carbazole is CCCCCCCCCc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 1-nonyl-9H-carbazole?
The InChIKey is GBEIZYKXXVPFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N/c1-2-3-4-5-6-7-8-12-17-13-11-15-19-18-14-9-10-16-20(18)22-21(17)19/h9-11,13-16,22H,2-8,12H2,1H3.
What are the key properties of 1-nonyl-9H-carbazole?
1-nonyl-9H-carbazole has a molecular weight of 293.45 g/mol, XLogP of 6.61, 8 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonyl-9H-carbazole is sourced from PubChem (CID 66872642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).