About 9H-carbazol-1-ylmethanol
9H-carbazol-1-ylmethanol (PubChem CID 10987211) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 9H-carbazol-1-ylmethanol.
Molecular Properties
| Compound Name | 9H-carbazol-1-ylmethanol |
| PubChem CID | 10987211 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 9H-carbazol-1-ylmethanol |
| SMILES | OCc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H11NO/c15-8-9-4-3-6-11-10-5-1-2-7-12(10)14-13(9)11/h1-7,14-15H,8H2 |
| InChIKey | NGMRNYIREGOYQZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazol-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazol-1-ylmethanol?
The IUPAC name of 9H-carbazol-1-ylmethanol (CID 10987211) is 9H-carbazol-1-ylmethanol.
What is the SMILES notation for 9H-carbazol-1-ylmethanol?
The canonical SMILES for 9H-carbazol-1-ylmethanol is OCc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 9H-carbazol-1-ylmethanol?
The InChIKey is NGMRNYIREGOYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c15-8-9-4-3-6-11-10-5-1-2-7-12(10)14-13(9)11/h1-7,14-15H,8H2.
What are the key properties of 9H-carbazol-1-ylmethanol?
9H-carbazol-1-ylmethanol has a molecular weight of 197.24 g/mol, XLogP of 2.81, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-1-ylmethanol is sourced from PubChem (CID 10987211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).