9H-carbazol-1-ylboronic acid

C12H10BNO2 — CID 53421584

IUPAC9H-carbazol-1-ylboronic acid
SMILESOB(O)c1cccc2c1[nH]c1ccccc12
InChIInChI=1S/C12H10BNO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14-16H
InChIKeyRIUUHLXAZCECMM-UHFFFAOYSA-N
MW211.03 g/mol
LogP1.00
Rot. Bonds1

About 9H-carbazol-1-ylboronic acid

9H-carbazol-1-ylboronic acid (PubChem CID 53421584) has the molecular formula C12H10BNO2 and a molecular weight of 211.03 g/mol. Its IUPAC name is 9H-carbazol-1-ylboronic acid.

Molecular Properties

Compound Name9H-carbazol-1-ylboronic acid
PubChem CID53421584
Molecular FormulaC12H10BNO2
Molecular Weight211.03 g/mol
Exact Mass211.08
IUPAC Name9H-carbazol-1-ylboronic acid
SMILESOB(O)c1cccc2c1[nH]c1ccccc12
InChIInChI=1S/C12H10BNO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14-16H
InChIKeyRIUUHLXAZCECMM-UHFFFAOYSA-N
XLogP1.00
TPSA56.25 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.03
LogP ≤ 51.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 9H-carbazol-1-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-carbazol-1-ylboronic acid?
The IUPAC name of 9H-carbazol-1-ylboronic acid (CID 53421584) is 9H-carbazol-1-ylboronic acid.
What is the SMILES notation for 9H-carbazol-1-ylboronic acid?
The canonical SMILES for 9H-carbazol-1-ylboronic acid is OB(O)c1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 9H-carbazol-1-ylboronic acid?
The InChIKey is RIUUHLXAZCECMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BNO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14-16H.
What are the key properties of 9H-carbazol-1-ylboronic acid?
9H-carbazol-1-ylboronic acid has a molecular weight of 211.03 g/mol, XLogP of 1.00, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-1-ylboronic acid is sourced from PubChem (CID 53421584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).