bis(9H-carbazol-1-yloxy)borinic acid

C24H17BN2O3 — CID 175014324

IUPACbis(9H-carbazol-1-yloxy)borinic acid
SMILESOB(Oc1cccc2c1[nH]c1ccccc12)Oc1cccc2c1[nH]c1ccccc12
InChIInChI=1S/C24H17BN2O3/c28-25(29-21-13-5-9-17-15-7-1-3-11-19(15)26-23(17)21)30-22-14-6-10-18-16-8-2-4-12-20(16)27-24(18)22/h1-14,26-28H
InChIKeyVCLFVCYSWUHCJS-UHFFFAOYSA-N
MW392.22 g/mol
LogP5.39
Rot. Bonds4

About bis(9H-carbazol-1-yloxy)borinic acid

bis(9H-carbazol-1-yloxy)borinic acid (PubChem CID 175014324) has the molecular formula C24H17BN2O3 and a molecular weight of 392.22 g/mol. Its IUPAC name is bis(9H-carbazol-1-yloxy)borinic acid.

Molecular Properties

Compound Namebis(9H-carbazol-1-yloxy)borinic acid
PubChem CID175014324
Molecular FormulaC24H17BN2O3
Molecular Weight392.22 g/mol
Exact Mass392.13
IUPAC Namebis(9H-carbazol-1-yloxy)borinic acid
SMILESOB(Oc1cccc2c1[nH]c1ccccc12)Oc1cccc2c1[nH]c1ccccc12
InChIInChI=1S/C24H17BN2O3/c28-25(29-21-13-5-9-17-15-7-1-3-11-19(15)26-23(17)21)30-22-14-6-10-18-16-8-2-4-12-20(16)27-24(18)22/h1-14,26-28H
InChIKeyVCLFVCYSWUHCJS-UHFFFAOYSA-N
XLogP5.39
TPSA70.27 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500392.22
LogP ≤ 55.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze bis(9H-carbazol-1-yloxy)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(9H-carbazol-1-yloxy)borinic acid?
The IUPAC name of bis(9H-carbazol-1-yloxy)borinic acid (CID 175014324) is bis(9H-carbazol-1-yloxy)borinic acid.
What is the SMILES notation for bis(9H-carbazol-1-yloxy)borinic acid?
The canonical SMILES for bis(9H-carbazol-1-yloxy)borinic acid is OB(Oc1cccc2c1[nH]c1ccccc12)Oc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of bis(9H-carbazol-1-yloxy)borinic acid?
The InChIKey is VCLFVCYSWUHCJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17BN2O3/c28-25(29-21-13-5-9-17-15-7-1-3-11-19(15)26-23(17)21)30-22-14-6-10-18-16-8-2-4-12-20(16)27-24(18)22/h1-14,26-28H.
What are the key properties of bis(9H-carbazol-1-yloxy)borinic acid?
bis(9H-carbazol-1-yloxy)borinic acid has a molecular weight of 392.22 g/mol, XLogP of 5.39, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-carbazol-1-yloxy)borinic acid is sourced from PubChem (CID 175014324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).