About 1-butyl-9H-carbazole;phosphane;hydrate
1-butyl-9H-carbazole;phosphane;hydrate (PubChem CID 174715058) has the molecular formula C16H22NOP
and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-butyl-9H-carbazole;phosphane;hydrate.
Molecular Properties
| Compound Name | 1-butyl-9H-carbazole;phosphane;hydrate |
| PubChem CID | 174715058 |
| Molecular Formula | C16H22NOP |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-butyl-9H-carbazole;phosphane;hydrate |
| SMILES | CCCCc1cccc2c1[nH]c1ccccc12.O.P |
| InChI | InChI=1S/C16H17N.H2O.H3P/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)17-16(12)14;;/h4-6,8-11,17H,2-3,7H2,1H3;1H2;1H3 |
| InChIKey | VTYNRCVEQQCLKR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-9H-carbazole;phosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-9H-carbazole;phosphane;hydrate?
The IUPAC name of 1-butyl-9H-carbazole;phosphane;hydrate (CID 174715058) is 1-butyl-9H-carbazole;phosphane;hydrate.
What is the SMILES notation for 1-butyl-9H-carbazole;phosphane;hydrate?
The canonical SMILES for 1-butyl-9H-carbazole;phosphane;hydrate is CCCCc1cccc2c1[nH]c1ccccc12.O.P.
What is the InChIKey of 1-butyl-9H-carbazole;phosphane;hydrate?
The InChIKey is VTYNRCVEQQCLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N.H2O.H3P/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)17-16(12)14;;/h4-6,8-11,17H,2-3,7H2,1H3;1H2;1H3.
What are the key properties of 1-butyl-9H-carbazole;phosphane;hydrate?
1-butyl-9H-carbazole;phosphane;hydrate has a molecular weight of 275.33 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-9H-carbazole;phosphane;hydrate is sourced from PubChem (CID 174715058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).