C19H24N2 — CID 21399518
1-butyl-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine (PubChem CID 21399518) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-butyl-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine.
| Compound Name | 1-butyl-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 21399518 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-butyl-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine |
| SMILES | CCCCC1=C2c3[nH]c4ccccc4c3CCN2CCC1 |
| InChI | InChI=1S/C19H24N2/c1-2-3-7-14-8-6-12-21-13-11-16-15-9-4-5-10-17(15)20-18(16)19(14)21/h4-5,9-10,20H,2-3,6-8,11-13H2,1H3 |
| InChIKey | XDACUDIWWMMNLB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |